About 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione
2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione (PubChem CID 50883390) has the molecular formula C10H6N6O2
and a molecular weight of 242.20 g/mol. Its IUPAC name is 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione.
Molecular Properties
| Compound Name | 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione |
| PubChem CID | 50883390 |
| Molecular Formula | C10H6N6O2 |
| Molecular Weight | 242.20 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione |
| SMILES | Nc1nnnn1N=c1c(=O)c2ccccc2c1=O |
| InChI | InChI=1S/C10H6N6O2/c11-10-12-14-15-16(10)13-7-8(17)5-3-1-2-4-6(5)9(7)18/h1-4H,(H2,11,12,15) |
| InChIKey | QTMIWMYTQOQSGK-UHFFFAOYSA-N |
| XLogP | -1.63 |
| TPSA | 116.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.20 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione?
The IUPAC name of 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione (CID 50883390) is 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione.
What is the SMILES notation for 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione?
The canonical SMILES for 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione is Nc1nnnn1N=c1c(=O)c2ccccc2c1=O.
What is the InChIKey of 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione?
The InChIKey is QTMIWMYTQOQSGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H6N6O2/c11-10-12-14-15-16(10)13-7-8(17)5-3-1-2-4-6(5)9(7)18/h1-4H,(H2,11,12,15).
What are the key properties of 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione?
2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione has a molecular weight of 242.20 g/mol, XLogP of -1.63, 1 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-aminotetrazol-1-yl)iminoindene-1,3-dione is sourced from PubChem (CID 50883390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).