About propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate
propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate (PubChem CID 50884577) has the molecular formula C24H17ClN2O3S
and a molecular weight of 448.93 g/mol. Its IUPAC name is propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate.
Molecular Properties
| Compound Name | propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate |
| PubChem CID | 50884577 |
| Molecular Formula | C24H17ClN2O3S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate |
| SMILES | CCCOC(=O)c1cc(-c2ccc(/C=C(/C#N)c3nc4ccccc4s3)o2)ccc1Cl |
| InChI | InChI=1S/C24H17ClN2O3S/c1-2-11-29-24(28)18-13-15(7-9-19(18)25)21-10-8-17(30-21)12-16(14-26)23-27-20-5-3-4-6-22(20)31-23/h3-10,12-13H,2,11H2,1H3/b16-12- |
| InChIKey | MLQVKOXHKIBHMV-VBKFSLOCSA-N |
| XLogP | 6.84 |
| TPSA | 76.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate?
The IUPAC name of propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate (CID 50884577) is propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate.
What is the SMILES notation for propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate?
The canonical SMILES for propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate is CCCOC(=O)c1cc(-c2ccc(/C=C(/C#N)c3nc4ccccc4s3)o2)ccc1Cl.
What is the InChIKey of propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate?
The InChIKey is MLQVKOXHKIBHMV-VBKFSLOCSA-N. The full InChI is InChI=1S/C24H17ClN2O3S/c1-2-11-29-24(28)18-13-15(7-9-19(18)25)21-10-8-17(30-21)12-16(14-26)23-27-20-5-3-4-6-22(20)31-23/h3-10,12-13H,2,11H2,1H3/b16-12-.
What are the key properties of propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate?
propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate has a molecular weight of 448.93 g/mol, XLogP of 6.84, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for propyl 5-[5-[(Z)-2-(1,3-benzothiazol-2-yl)-2-cyanoethenyl]furan-2-yl]-2-chlorobenzoate is sourced from PubChem (CID 50884577), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).