About 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide
4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide (PubChem CID 50884971) has the molecular formula C16H17N5O3S
and a molecular weight of 359.41 g/mol. Its IUPAC name is 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide |
| PubChem CID | 50884971 |
| Molecular Formula | C16H17N5O3S |
| Molecular Weight | 359.41 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide |
| SMILES | Cn1c(=O)n(C)c2cc(C=NNc3ccc(S(N)(=O)=O)cc3)ccc21 |
| InChI | InChI=1S/C16H17N5O3S/c1-20-14-8-3-11(9-15(14)21(2)16(20)22)10-18-19-12-4-6-13(7-5-12)25(17,23)24/h3-10,19H,1-2H3,(H2,17,23,24) |
| InChIKey | YDEZKQHTIXPQIC-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 111.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide?
The IUPAC name of 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide (CID 50884971) is 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide.
What is the SMILES notation for 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide?
The canonical SMILES for 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide is Cn1c(=O)n(C)c2cc(C=NNc3ccc(S(N)(=O)=O)cc3)ccc21.
What is the InChIKey of 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide?
The InChIKey is YDEZKQHTIXPQIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5O3S/c1-20-14-8-3-11(9-15(14)21(2)16(20)22)10-18-19-12-4-6-13(7-5-12)25(17,23)24/h3-10,19H,1-2H3,(H2,17,23,24).
What are the key properties of 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide?
4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide has a molecular weight of 359.41 g/mol, XLogP of 0.97, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[(1,3-dimethyl-2-oxobenzimidazol-5-yl)methylidene]hydrazinyl]benzenesulfonamide is sourced from PubChem (CID 50884971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).