C20H16N2O4S2 — CID 50885603
4-[5-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]furan-2-yl]benzenesulfonic acid (PubChem CID 50885603) has the molecular formula C20H16N2O4S2 and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-[5-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]furan-2-yl]benzenesulfonic acid.
| Compound Name | 4-[5-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]furan-2-yl]benzenesulfonic acid |
|---|---|
| PubChem CID | 50885603 |
| Molecular Formula | C20H16N2O4S2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.06 |
| IUPAC Name | 4-[5-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]furan-2-yl]benzenesulfonic acid |
| SMILES | N#Cc1c(N=Cc2ccc(-c3ccc(S(=O)(=O)O)cc3)o2)sc2c1CCCC2 |
| InChI | InChI=1S/C20H16N2O4S2/c21-11-17-16-3-1-2-4-19(16)27-20(17)22-12-14-7-10-18(26-14)13-5-8-15(9-6-13)28(23,24)25/h5-10,12H,1-4H2,(H,23,24,25) |
| InChIKey | HHNNMMXYJLTXPZ-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 103.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|