C17H12N6O — CID 50885769
(3Z)-2-amino-4-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)buta-1,3-diene-1,1,3-tricarbonitrile (PubChem CID 50885769) has the molecular formula C17H12N6O and a molecular weight of 316.32 g/mol. Its IUPAC name is (3Z)-2-amino-4-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)buta-1,3-diene-1,1,3-tricarbonitrile.
| Compound Name | (3Z)-2-amino-4-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)buta-1,3-diene-1,1,3-tricarbonitrile |
|---|---|
| PubChem CID | 50885769 |
| Molecular Formula | C17H12N6O |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | (3Z)-2-amino-4-(5-methyl-3-oxo-2-phenyl-1H-pyrazol-4-yl)buta-1,3-diene-1,1,3-tricarbonitrile |
| SMILES | Cc1[nH]n(-c2ccccc2)c(=O)c1/C=C(\C#N)C(N)=C(C#N)C#N |
| InChI | InChI=1S/C17H12N6O/c1-11-15(7-12(8-18)16(21)13(9-19)10-20)17(24)23(22-11)14-5-3-2-4-6-14/h2-7,22H,21H2,1H3/b12-7+ |
| InChIKey | WIBRAPTVIHGLLX-KPKJPENVSA-N |
| XLogP | 1.64 |
| TPSA | 135.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|