C34H24N2O7 — CID 50886156
dibenzyl 5-[5-[(Z)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzene-1,3-dicarboxylate (PubChem CID 50886156) has the molecular formula C34H24N2O7 and a molecular weight of 572.57 g/mol. Its IUPAC name is dibenzyl 5-[5-[(Z)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzene-1,3-dicarboxylate.
| Compound Name | dibenzyl 5-[5-[(Z)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 50886156 |
| Molecular Formula | C34H24N2O7 |
| Molecular Weight | 572.57 g/mol |
| Exact Mass | 572.16 |
| IUPAC Name | dibenzyl 5-[5-[(Z)-(5-cyano-4-methyl-2,6-dioxo-3-pyridinylidene)methyl]furan-2-yl]benzene-1,3-dicarboxylate |
| SMILES | CC1=C(C#N)C(=O)NC(=O)/C1=C\c1ccc(-c2cc(C(=O)OCc3ccccc3)cc(C(=O)OCc3ccccc3)c2)o1 |
| InChI | InChI=1S/C34H24N2O7/c1-21-28(31(37)36-32(38)29(21)18-35)17-27-12-13-30(43-27)24-14-25(33(39)41-19-22-8-4-2-5-9-22)16-26(15-24)34(40)42-20-23-10-6-3-7-11-23/h2-17H,19-20H2,1H3,(H,36,37,38)/b28-17- |
| InChIKey | FOWBYRSWENGAOR-QRQIAZFYSA-N |
| XLogP | 5.54 |
| TPSA | 135.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.57 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|