C27H26N2O3S — CID 50887817
cyclohexyl 3-[5-[(E)-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]furan-2-yl]benzoate (PubChem CID 50887817) has the molecular formula C27H26N2O3S and a molecular weight of 458.58 g/mol. Its IUPAC name is cyclohexyl 3-[5-[(E)-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]furan-2-yl]benzoate.
| Compound Name | cyclohexyl 3-[5-[(E)-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 50887817 |
| Molecular Formula | C27H26N2O3S |
| Molecular Weight | 458.58 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | cyclohexyl 3-[5-[(E)-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)iminomethyl]furan-2-yl]benzoate |
| SMILES | N#Cc1c(/N=C/c2ccc(-c3cccc(C(=O)OC4CCCCC4)c3)o2)sc2c1CCCC2 |
| InChI | InChI=1S/C27H26N2O3S/c28-16-23-22-11-4-5-12-25(22)33-26(23)29-17-21-13-14-24(31-21)18-7-6-8-19(15-18)27(30)32-20-9-2-1-3-10-20/h6-8,13-15,17,20H,1-5,9-12H2/b29-17+ |
| InChIKey | HQTGRICHJFSETM-STBIYBPSSA-N |
| XLogP | 7.00 |
| TPSA | 75.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.58 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|