C18H14ClNO4 — CID 50888142
benzyl 2-chloro-5-(2,5-dioxopyrrolidin-1-yl)benzoate (PubChem CID 50888142) has the molecular formula C18H14ClNO4 and a molecular weight of 343.77 g/mol. Its IUPAC name is benzyl 2-chloro-5-(2,5-dioxopyrrolidin-1-yl)benzoate.
| Compound Name | benzyl 2-chloro-5-(2,5-dioxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 50888142 |
| Molecular Formula | C18H14ClNO4 |
| Molecular Weight | 343.77 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | benzyl 2-chloro-5-(2,5-dioxopyrrolidin-1-yl)benzoate |
| SMILES | O=C(OCc1ccccc1)c1cc(N2C(=O)CCC2=O)ccc1Cl |
| InChI | InChI=1S/C18H14ClNO4/c19-15-7-6-13(20-16(21)8-9-17(20)22)10-14(15)18(23)24-11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2 |
| InChIKey | KJWPTWWXVLGIIT-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|