C11H18N2O2 — CID 50888392
ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)acetate (PubChem CID 50888392) has the molecular formula C11H18N2O2 and a molecular weight of 210.28 g/mol. Its IUPAC name is ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)acetate.
| Compound Name | ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)acetate |
|---|---|
| PubChem CID | 50888392 |
| Molecular Formula | C11H18N2O2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | ethyl 2-(4-ethyl-3,5-dimethylpyrazol-1-yl)acetate |
| SMILES | CCOC(=O)Cn1nc(C)c(CC)c1C |
| InChI | InChI=1S/C11H18N2O2/c1-5-10-8(3)12-13(9(10)4)7-11(14)15-6-2/h5-7H2,1-4H3 |
| InChIKey | NOEXSSDNEUWXSX-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |