About 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid
2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid (PubChem CID 50888910) has the molecular formula C13H9ClN2O4
and a molecular weight of 292.68 g/mol. Its IUPAC name is 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid.
Molecular Properties
| Compound Name | 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid |
| PubChem CID | 50888910 |
| Molecular Formula | C13H9ClN2O4 |
| Molecular Weight | 292.68 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid |
| SMILES | Cc1nn(-c2ccc(Cl)c(C(=O)O)c2)c2c1CC(=O)O2 |
| InChI | InChI=1S/C13H9ClN2O4/c1-6-8-5-11(17)20-12(8)16(15-6)7-2-3-10(14)9(4-7)13(18)19/h2-4H,5H2,1H3,(H,18,19) |
| InChIKey | AGWSSVNLUFQLCG-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.68 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid?
The IUPAC name of 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid (CID 50888910) is 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid.
What is the SMILES notation for 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid?
The canonical SMILES for 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid is Cc1nn(-c2ccc(Cl)c(C(=O)O)c2)c2c1CC(=O)O2.
What is the InChIKey of 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid?
The InChIKey is AGWSSVNLUFQLCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H9ClN2O4/c1-6-8-5-11(17)20-12(8)16(15-6)7-2-3-10(14)9(4-7)13(18)19/h2-4H,5H2,1H3,(H,18,19).
What are the key properties of 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid?
2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid has a molecular weight of 292.68 g/mol, XLogP of 1.99, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-5-(3-methyl-5-oxo-4H-furo[3,2-d]pyrazol-1-yl)benzoic acid is sourced from PubChem (CID 50888910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).