C15H17N3O3S — CID 50889911
N-(2-hydrazinyl-2-oxoethyl)-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 50889911) has the molecular formula C15H17N3O3S and a molecular weight of 319.39 g/mol. Its IUPAC name is N-(2-hydrazinyl-2-oxoethyl)-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | N-(2-hydrazinyl-2-oxoethyl)-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50889911 |
| Molecular Formula | C15H17N3O3S |
| Molecular Weight | 319.39 g/mol |
| Exact Mass | 319.10 |
| IUPAC Name | N-(2-hydrazinyl-2-oxoethyl)-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(N(CC(=O)NN)S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H17N3O3S/c1-12-7-9-13(10-8-12)18(11-15(19)17-16)22(20,21)14-5-3-2-4-6-14/h2-10H,11,16H2,1H3,(H,17,19) |
| InChIKey | CQPTXXPTLTVEPZ-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|