C14H11ClFNO4S — CID 50890513
2-(N-(4-chlorophenyl)sulfonyl-3-fluoroanilino)acetic acid (PubChem CID 50890513) has the molecular formula C14H11ClFNO4S and a molecular weight of 343.76 g/mol. Its IUPAC name is 2-(N-(4-chlorophenyl)sulfonyl-3-fluoroanilino)acetic acid.
| Compound Name | 2-(N-(4-chlorophenyl)sulfonyl-3-fluoroanilino)acetic acid |
|---|---|
| PubChem CID | 50890513 |
| Molecular Formula | C14H11ClFNO4S |
| Molecular Weight | 343.76 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | 2-(N-(4-chlorophenyl)sulfonyl-3-fluoroanilino)acetic acid |
| SMILES | O=C(O)CN(c1cccc(F)c1)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H11ClFNO4S/c15-10-4-6-13(7-5-10)22(20,21)17(9-14(18)19)12-3-1-2-11(16)8-12/h1-8H,9H2,(H,18,19) |
| InChIKey | PZJKQCIXCQAWAB-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.76 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |