C16H17FN2O3S — CID 50891717
2-(N-(4-fluorophenyl)sulfonyl-2,5-dimethylanilino)acetamide (PubChem CID 50891717) has the molecular formula C16H17FN2O3S and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-(N-(4-fluorophenyl)sulfonyl-2,5-dimethylanilino)acetamide.
| Compound Name | 2-(N-(4-fluorophenyl)sulfonyl-2,5-dimethylanilino)acetamide |
|---|---|
| PubChem CID | 50891717 |
| Molecular Formula | C16H17FN2O3S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-(N-(4-fluorophenyl)sulfonyl-2,5-dimethylanilino)acetamide |
| SMILES | Cc1ccc(C)c(N(CC(N)=O)S(=O)(=O)c2ccc(F)cc2)c1 |
| InChI | InChI=1S/C16H17FN2O3S/c1-11-3-4-12(2)15(9-11)19(10-16(18)20)23(21,22)14-7-5-13(17)6-8-14/h3-9H,10H2,1-2H3,(H2,18,20) |
| InChIKey | SFUZSFSZTGCKOG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |