C15H12BrCl2NO4S — CID 50892386
2-(N-(4-bromophenyl)sulfonyl-2,3-dichloroanilino)propanoic acid (PubChem CID 50892386) has the molecular formula C15H12BrCl2NO4S and a molecular weight of 453.14 g/mol. Its IUPAC name is 2-(N-(4-bromophenyl)sulfonyl-2,3-dichloroanilino)propanoic acid.
| Compound Name | 2-(N-(4-bromophenyl)sulfonyl-2,3-dichloroanilino)propanoic acid |
|---|---|
| PubChem CID | 50892386 |
| Molecular Formula | C15H12BrCl2NO4S |
| Molecular Weight | 453.14 g/mol |
| Exact Mass | 450.90 |
| IUPAC Name | 2-(N-(4-bromophenyl)sulfonyl-2,3-dichloroanilino)propanoic acid |
| SMILES | CC(C(=O)O)N(c1cccc(Cl)c1Cl)S(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H12BrCl2NO4S/c1-9(15(20)21)19(13-4-2-3-12(17)14(13)18)24(22,23)11-7-5-10(16)6-8-11/h2-9H,1H3,(H,20,21) |
| InChIKey | VMXWBJJJBQNSOB-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.14 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |