C10H11Cl2NO4S — CID 50892451
3-(3,5-dichloro-N-methylsulfonylanilino)propanoic acid (PubChem CID 50892451) has the molecular formula C10H11Cl2NO4S and a molecular weight of 312.17 g/mol. Its IUPAC name is 3-(3,5-dichloro-N-methylsulfonylanilino)propanoic acid.
| Compound Name | 3-(3,5-dichloro-N-methylsulfonylanilino)propanoic acid |
|---|---|
| PubChem CID | 50892451 |
| Molecular Formula | C10H11Cl2NO4S |
| Molecular Weight | 312.17 g/mol |
| Exact Mass | 310.98 |
| IUPAC Name | 3-(3,5-dichloro-N-methylsulfonylanilino)propanoic acid |
| SMILES | CS(=O)(=O)N(CCC(=O)O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C10H11Cl2NO4S/c1-18(16,17)13(3-2-10(14)15)9-5-7(11)4-8(12)6-9/h4-6H,2-3H2,1H3,(H,14,15) |
| InChIKey | MORPNSVIMFFHEN-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.17 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |