C25H17F3N4O3S2 — CID 5089428
3-amino-6-(1,3-benzodioxol-5-yl)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 5089428) has the molecular formula C25H17F3N4O3S2 and a molecular weight of 542.56 g/mol. Its IUPAC name is 3-amino-6-(1,3-benzodioxol-5-yl)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-6-(1,3-benzodioxol-5-yl)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 5089428 |
| Molecular Formula | C25H17F3N4O3S2 |
| Molecular Weight | 542.56 g/mol |
| Exact Mass | 542.07 |
| IUPAC Name | 3-amino-6-(1,3-benzodioxol-5-yl)-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)-4-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | N#Cc1c(NC(=O)c2sc3nc(-c4ccc5c(c4)OCO5)cc(C(F)(F)F)c3c2N)sc2c1CCCC2 |
| InChI | InChI=1S/C25H17F3N4O3S2/c26-25(27,28)14-8-15(11-5-6-16-17(7-11)35-10-34-16)31-24-19(14)20(30)21(37-24)22(33)32-23-13(9-29)12-3-1-2-4-18(12)36-23/h5-8H,1-4,10,30H2,(H,32,33) |
| InChIKey | VCWQCBBDJVSAFT-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.56 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |