C15H14BrF3N2O3 — CID 50895879
2-[5-bromo-3-(2,2,2-trifluoroacetyl)indol-1-yl]-N-(2-methoxyethyl)acetamide (PubChem CID 50895879) has the molecular formula C15H14BrF3N2O3 and a molecular weight of 407.19 g/mol. Its IUPAC name is 2-[5-bromo-3-(2,2,2-trifluoroacetyl)indol-1-yl]-N-(2-methoxyethyl)acetamide.
| Compound Name | 2-[5-bromo-3-(2,2,2-trifluoroacetyl)indol-1-yl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 50895879 |
| Molecular Formula | C15H14BrF3N2O3 |
| Molecular Weight | 407.19 g/mol |
| Exact Mass | 406.01 |
| IUPAC Name | 2-[5-bromo-3-(2,2,2-trifluoroacetyl)indol-1-yl]-N-(2-methoxyethyl)acetamide |
| SMILES | COCCNC(=O)Cn1cc(C(=O)C(F)(F)F)c2cc(Br)ccc21 |
| InChI | InChI=1S/C15H14BrF3N2O3/c1-24-5-4-20-13(22)8-21-7-11(14(23)15(17,18)19)10-6-9(16)2-3-12(10)21/h2-3,6-7H,4-5,8H2,1H3,(H,20,22) |
| InChIKey | FWLOLMRKYBRWCU-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.19 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|