C10H4ClFN4OS — CID 50895897
6-(2-fluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-3-carbonyl chloride (PubChem CID 50895897) has the molecular formula C10H4ClFN4OS and a molecular weight of 282.69 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-3-carbonyl chloride.
| Compound Name | 6-(2-fluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-3-carbonyl chloride |
|---|---|
| PubChem CID | 50895897 |
| Molecular Formula | C10H4ClFN4OS |
| Molecular Weight | 282.69 g/mol |
| Exact Mass | 281.98 |
| IUPAC Name | 6-(2-fluorophenyl)-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-3-carbonyl chloride |
| SMILES | O=C(Cl)c1nnc2sc(-c3ccccc3F)nn12 |
| InChI | InChI=1S/C10H4ClFN4OS/c11-7(17)8-13-14-10-16(8)15-9(18-10)5-3-1-2-4-6(5)12/h1-4H |
| InChIKey | SSJQLPBDTXPJIL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 60.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.69 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|