C11H11BFNO4 — CID 50896237
2-(4-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione (PubChem CID 50896237) has the molecular formula C11H11BFNO4 and a molecular weight of 251.02 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione.
| Compound Name | 2-(4-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
|---|---|
| PubChem CID | 50896237 |
| Molecular Formula | C11H11BFNO4 |
| Molecular Weight | 251.02 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-(4-fluorophenyl)-6-methyl-1,3,6,2-dioxazaborocane-4,8-dione |
| SMILES | CN1CC(=O)OB(c2ccc(F)cc2)OC(=O)C1 |
| InChI | InChI=1S/C11H11BFNO4/c1-14-6-10(15)17-12(18-11(16)7-14)8-2-4-9(13)5-3-8/h2-5H,6-7H2,1H3 |
| InChIKey | VRWBUFHGNOFGKX-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.02 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|