C6H7F2N3O2 — CID 50896503
1-(2,2-difluoroethyl)-3-methyl-4-nitropyrazole (PubChem CID 50896503) has the molecular formula C6H7F2N3O2 and a molecular weight of 191.14 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-methyl-4-nitropyrazole.
| Compound Name | 1-(2,2-difluoroethyl)-3-methyl-4-nitropyrazole |
|---|---|
| PubChem CID | 50896503 |
| Molecular Formula | C6H7F2N3O2 |
| Molecular Weight | 191.14 g/mol |
| Exact Mass | 191.05 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-methyl-4-nitropyrazole |
| SMILES | Cc1nn(CC(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C6H7F2N3O2/c1-4-5(11(12)13)2-10(9-4)3-6(7)8/h2,6H,3H2,1H3 |
| InChIKey | GJZJOWIMJNCWCG-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|