C11H14FNO2S — CID 50896517
1-[(5-fluorothiophen-2-yl)methyl]piperidine-4-carboxylic acid (PubChem CID 50896517) has the molecular formula C11H14FNO2S and a molecular weight of 243.30 g/mol. Its IUPAC name is 1-[(5-fluorothiophen-2-yl)methyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(5-fluorothiophen-2-yl)methyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 50896517 |
| Molecular Formula | C11H14FNO2S |
| Molecular Weight | 243.30 g/mol |
| Exact Mass | 243.07 |
| IUPAC Name | 1-[(5-fluorothiophen-2-yl)methyl]piperidine-4-carboxylic acid |
| SMILES | O=C(O)C1CCN(Cc2ccc(F)s2)CC1 |
| InChI | InChI=1S/C11H14FNO2S/c12-10-2-1-9(16-10)7-13-5-3-8(4-6-13)11(14)15/h1-2,8H,3-7H2,(H,14,15) |
| InChIKey | DVHZJJKPKBPDKK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |