C8H16F2N2O — CID 50896662
2,2-difluoro-N-(2-morpholin-4-ylethyl)ethanamine (PubChem CID 50896662) has the molecular formula C8H16F2N2O and a molecular weight of 194.22 g/mol. Its IUPAC name is 2,2-difluoro-N-(2-morpholin-4-ylethyl)ethanamine.
| Compound Name | 2,2-difluoro-N-(2-morpholin-4-ylethyl)ethanamine |
|---|---|
| PubChem CID | 50896662 |
| Molecular Formula | C8H16F2N2O |
| Molecular Weight | 194.22 g/mol |
| Exact Mass | 194.12 |
| IUPAC Name | 2,2-difluoro-N-(2-morpholin-4-ylethyl)ethanamine |
| SMILES | FC(F)CNCCN1CCOCC1 |
| InChI | InChI=1S/C8H16F2N2O/c9-8(10)7-11-1-2-12-3-5-13-6-4-12/h8,11H,1-7H2 |
| InChIKey | UCBDLUXNBMRCPK-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.22 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|