methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate

C9H15F2NO2 — CID 50896779

IUPACmethyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate
SMILESCOC(=O)C1CCN(CC(F)F)CC1
InChIInChI=1S/C9H15F2NO2/c1-14-9(13)7-2-4-12(5-3-7)6-8(10)11/h7-8H,2-6H2,1H3
InChIKeyZVJVACVGNKVVEW-UHFFFAOYSA-N
MW207.22 g/mol
LogP1.14
Rot. Bonds3

About methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate

methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate (PubChem CID 50896779) has the molecular formula C9H15F2NO2 and a molecular weight of 207.22 g/mol. Its IUPAC name is methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate.

Molecular Properties

Compound Namemethyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate
PubChem CID50896779
Molecular FormulaC9H15F2NO2
Molecular Weight207.22 g/mol
Exact Mass207.11
IUPAC Namemethyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate
SMILESCOC(=O)C1CCN(CC(F)F)CC1
InChIInChI=1S/C9H15F2NO2/c1-14-9(13)7-2-4-12(5-3-7)6-8(10)11/h7-8H,2-6H2,1H3
InChIKeyZVJVACVGNKVVEW-UHFFFAOYSA-N
XLogP1.14
TPSA29.54 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.22
LogP ≤ 51.14
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate?
The IUPAC name of methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate (CID 50896779) is methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate.
What is the SMILES notation for methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate?
The canonical SMILES for methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate is COC(=O)C1CCN(CC(F)F)CC1.
What is the InChIKey of methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate?
The InChIKey is ZVJVACVGNKVVEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15F2NO2/c1-14-9(13)7-2-4-12(5-3-7)6-8(10)11/h7-8H,2-6H2,1H3.
What are the key properties of methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate?
methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate has a molecular weight of 207.22 g/mol, XLogP of 1.14, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2,2-difluoroethyl)piperidine-4-carboxylate is sourced from PubChem (CID 50896779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).