About copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate
copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate (PubChem CID 50897049) has the molecular formula C12H12CuN3O4+
and a molecular weight of 325.79 g/mol. Its IUPAC name is copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate.
Molecular Properties
| Compound Name | copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate |
| PubChem CID | 50897049 |
| Molecular Formula | C12H12CuN3O4+ |
| Molecular Weight | 325.79 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate |
| SMILES | O.O.O=C(/N=C(\[O-])c1ccccn1)c1ccccn1.[Cu+2] |
| InChI | InChI=1S/C12H9N3O2.Cu.2H2O/c16-11(9-5-1-3-7-13-9)15-12(17)10-6-2-4-8-14-10;;;/h1-8H,(H,15,16,17);;2*1H2/q;+2;;/p-1 |
| InChIKey | WRUAICTXEZSEOS-UHFFFAOYSA-M |
| XLogP | -1.23 |
| TPSA | 141.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.79 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate?
The IUPAC name of copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate (CID 50897049) is copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate.
What is the SMILES notation for copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate?
The canonical SMILES for copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate is O.O.O=C(/N=C(\[O-])c1ccccn1)c1ccccn1.[Cu+2].
What is the InChIKey of copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate?
The InChIKey is WRUAICTXEZSEOS-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H9N3O2.Cu.2H2O/c16-11(9-5-1-3-7-13-9)15-12(17)10-6-2-4-8-14-10;;;/h1-8H,(H,15,16,17);;2*1H2/q;+2;;/p-1.
What are the key properties of copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate?
copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate has a molecular weight of 325.79 g/mol, XLogP of -1.23, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for copper;N-(pyridine-2-carbonyl)pyridine-2-carboximidate;dihydrate is sourced from PubChem (CID 50897049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).