C44H34Cl2N8O5 — CID 50898368
2-[2,7-dichloro-3-hydroxy-6-oxo-4,5-bis[[pyrazin-2-ylmethyl(pyridin-2-ylmethyl)amino]methyl]xanthen-9-yl]benzoic acid (PubChem CID 50898368) has the molecular formula C44H34Cl2N8O5 and a molecular weight of 825.71 g/mol. Its IUPAC name is 2-[2,7-dichloro-3-hydroxy-6-oxo-4,5-bis[[pyrazin-2-ylmethyl(pyridin-2-ylmethyl)amino]methyl]xanthen-9-yl]benzoic acid.
| Compound Name | 2-[2,7-dichloro-3-hydroxy-6-oxo-4,5-bis[[pyrazin-2-ylmethyl(pyridin-2-ylmethyl)amino]methyl]xanthen-9-yl]benzoic acid |
|---|---|
| PubChem CID | 50898368 |
| Molecular Formula | C44H34Cl2N8O5 |
| Molecular Weight | 825.71 g/mol |
| Exact Mass | 824.20 |
| IUPAC Name | 2-[2,7-dichloro-3-hydroxy-6-oxo-4,5-bis[[pyrazin-2-ylmethyl(pyridin-2-ylmethyl)amino]methyl]xanthen-9-yl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c2cc(Cl)c(=O)c(CN(Cc3ccccn3)Cc3cnccn3)c-2oc2c(CN(Cc3ccccn3)Cc3cnccn3)c(O)c(Cl)cc12 |
| InChI | InChI=1S/C44H34Cl2N8O5/c45-37-17-33-39(31-9-1-2-10-32(31)44(57)58)34-18-38(46)41(56)36(26-54(22-28-8-4-6-12-50-28)24-30-20-48-14-16-52-30)43(34)59-42(33)35(40(37)55)25-53(21-27-7-3-5-11-49-27)23-29-19-47-13-15-51-29/h1-20,55H,21-26H2,(H,57,58) |
| InChIKey | YZMZCXUXWVQDDX-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 171.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 59 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 825.71 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|