C19H27N3O2 — CID 50898508
6-(2,6-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-N-hydroxyhexanamide (PubChem CID 50898508) has the molecular formula C19H27N3O2 and a molecular weight of 329.44 g/mol. Its IUPAC name is 6-(2,6-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-N-hydroxyhexanamide.
| Compound Name | 6-(2,6-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-N-hydroxyhexanamide |
|---|---|
| PubChem CID | 50898508 |
| Molecular Formula | C19H27N3O2 |
| Molecular Weight | 329.44 g/mol |
| Exact Mass | 329.21 |
| IUPAC Name | 6-(2,6-dimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-N-hydroxyhexanamide |
| SMILES | Cc1cccc2c3c(n(CCCCCC(=O)NO)c12)CCN(C)C3 |
| InChI | InChI=1S/C19H27N3O2/c1-14-7-6-8-15-16-13-21(2)12-10-17(16)22(19(14)15)11-5-3-4-9-18(23)20-24/h6-8,24H,3-5,9-13H2,1-2H3,(H,20,23) |
| InChIKey | SCWJSZKULJRVNC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|