C35H31F5O4 — CID 50898509
4-[2-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethynyl]benzoic acid (PubChem CID 50898509) has the molecular formula C35H31F5O4 and a molecular weight of 610.62 g/mol. Its IUPAC name is 4-[2-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethynyl]benzoic acid.
| Compound Name | 4-[2-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethynyl]benzoic acid |
|---|---|
| PubChem CID | 50898509 |
| Molecular Formula | C35H31F5O4 |
| Molecular Weight | 610.62 g/mol |
| Exact Mass | 610.21 |
| IUPAC Name | 4-[2-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethynyl]benzoic acid |
| SMILES | C[C@]12C[C@H](c3ccc(C#Cc4ccc(C(=O)O)cc4)cc3)C3=C4CCC(=O)C=C4CC[C@H]3[C@@H]1CC[C@@]2(O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C35H31F5O4/c1-32-19-28(22-8-4-20(5-9-22)2-3-21-6-10-23(11-7-21)31(42)43)30-26-15-13-25(41)18-24(26)12-14-27(30)29(32)16-17-33(32,44)34(36,37)35(38,39)40/h4-11,18,27-29,44H,12-17,19H2,1H3,(H,42,43)/t27-,28+,29-,32-,33-/m0/s1 |
| InChIKey | NMMHJXCADQJFAP-IUBAKRFESA-N |
| XLogP | 7.61 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.62 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|