C36H33F5O4 — CID 50898510
methyl 3-[2-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethynyl]benzoate (PubChem CID 50898510) has the molecular formula C36H33F5O4 and a molecular weight of 624.65 g/mol. Its IUPAC name is methyl 3-[2-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethynyl]benzoate.
| Compound Name | methyl 3-[2-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethynyl]benzoate |
|---|---|
| PubChem CID | 50898510 |
| Molecular Formula | C36H33F5O4 |
| Molecular Weight | 624.65 g/mol |
| Exact Mass | 624.23 |
| IUPAC Name | methyl 3-[2-[4-[(8S,11R,13S,14S,17S)-17-hydroxy-13-methyl-3-oxo-17-(1,1,2,2,2-pentafluoroethyl)-1,2,6,7,8,11,12,14,15,16-decahydrocyclopenta[a]phenanthren-11-yl]phenyl]ethynyl]benzoate |
| SMILES | COC(=O)c1cccc(C#Cc2ccc([C@H]3C[C@@]4(C)[C@@H](CC[C@@]4(O)C(F)(F)C(F)(F)F)[C@@H]4CCC5=CC(=O)CCC5=C43)cc2)c1 |
| InChI | InChI=1S/C36H33F5O4/c1-33-20-29(23-10-8-21(9-11-23)6-7-22-4-3-5-25(18-22)32(43)45-2)31-27-15-13-26(42)19-24(27)12-14-28(31)30(33)16-17-34(33,44)35(37,38)36(39,40)41/h3-5,8-11,18-19,28-30,44H,12-17,20H2,1-2H3/t28-,29+,30-,33-,34-/m0/s1 |
| InChIKey | DEKHCALHDFDIOV-BWQSSOLDSA-N |
| XLogP | 7.70 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.65 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|