C22H23N5O2 — CID 50898619
2-[(3aS,6aR)-2-(naphthalen-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-hydroxypyrimidine-5-carboxamide (PubChem CID 50898619) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 2-[(3aS,6aR)-2-(naphthalen-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-hydroxypyrimidine-5-carboxamide.
| Compound Name | 2-[(3aS,6aR)-2-(naphthalen-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-hydroxypyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 50898619 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 2-[(3aS,6aR)-2-(naphthalen-2-ylmethyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrol-5-yl]-N-hydroxypyrimidine-5-carboxamide |
| SMILES | O=C(NO)c1cnc(N2C[C@H]3CN(Cc4ccc5ccccc5c4)C[C@H]3C2)nc1 |
| InChI | InChI=1S/C22H23N5O2/c28-21(25-29)18-8-23-22(24-9-18)27-13-19-11-26(12-20(19)14-27)10-15-5-6-16-3-1-2-4-17(16)7-15/h1-9,19-20,29H,10-14H2,(H,25,28)/t19-,20+ |
| InChIKey | KPGKJQJLWZJYMJ-BGYRXZFFSA-N |
| XLogP | 2.32 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|