C30H43N3O6 — CID 50898699
2,2-dimethylpropanoyloxymethyl 6-[4-[(3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carbonylamino)methyl]piperidin-1-yl]hexanoate (PubChem CID 50898699) has the molecular formula C30H43N3O6 and a molecular weight of 541.69 g/mol. Its IUPAC name is 2,2-dimethylpropanoyloxymethyl 6-[4-[(3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carbonylamino)methyl]piperidin-1-yl]hexanoate.
| Compound Name | 2,2-dimethylpropanoyloxymethyl 6-[4-[(3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carbonylamino)methyl]piperidin-1-yl]hexanoate |
|---|---|
| PubChem CID | 50898699 |
| Molecular Formula | C30H43N3O6 |
| Molecular Weight | 541.69 g/mol |
| Exact Mass | 541.32 |
| IUPAC Name | 2,2-dimethylpropanoyloxymethyl 6-[4-[(3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carbonylamino)methyl]piperidin-1-yl]hexanoate |
| SMILES | CC(C)(C)C(=O)OCOC(=O)CCCCCN1CCC(CNC(=O)c2c3n(c4ccccc24)CCCO3)CC1 |
| InChI | InChI=1S/C30H43N3O6/c1-30(2,3)29(36)39-21-38-25(34)12-5-4-8-15-32-17-13-22(14-18-32)20-31-27(35)26-23-10-6-7-11-24(23)33-16-9-19-37-28(26)33/h6-7,10-11,22H,4-5,8-9,12-21H2,1-3H3,(H,31,35) |
| InChIKey | OWBBNQRRUQTBQD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.69 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|