C31H39N3O4 — CID 50898775
benzyl 6-[4-[(3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carbonylamino)methyl]piperidin-1-yl]hexanoate (PubChem CID 50898775) has the molecular formula C31H39N3O4 and a molecular weight of 517.67 g/mol. Its IUPAC name is benzyl 6-[4-[(3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carbonylamino)methyl]piperidin-1-yl]hexanoate.
| Compound Name | benzyl 6-[4-[(3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carbonylamino)methyl]piperidin-1-yl]hexanoate |
|---|---|
| PubChem CID | 50898775 |
| Molecular Formula | C31H39N3O4 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | benzyl 6-[4-[(3,4-dihydro-2H-[1,3]oxazino[3,2-a]indole-10-carbonylamino)methyl]piperidin-1-yl]hexanoate |
| SMILES | O=C(CCCCCN1CCC(CNC(=O)c2c3n(c4ccccc24)CCCO3)CC1)OCc1ccccc1 |
| InChI | InChI=1S/C31H39N3O4/c35-28(38-23-25-10-3-1-4-11-25)14-5-2-8-17-33-19-15-24(16-20-33)22-32-30(36)29-26-12-6-7-13-27(26)34-18-9-21-37-31(29)34/h1,3-4,6-7,10-13,24H,2,5,8-9,14-23H2,(H,32,36) |
| InChIKey | QQTDBAJKECZRPE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|