C21H26Cl3NO3 — CID 50898779
(1R,4aS,9E,10aR)-5,6,8-trichloro-9-methoxyimino-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid (PubChem CID 50898779) has the molecular formula C21H26Cl3NO3 and a molecular weight of 446.80 g/mol. Its IUPAC name is (1R,4aS,9E,10aR)-5,6,8-trichloro-9-methoxyimino-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid.
| Compound Name | (1R,4aS,9E,10aR)-5,6,8-trichloro-9-methoxyimino-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
|---|---|
| PubChem CID | 50898779 |
| Molecular Formula | C21H26Cl3NO3 |
| Molecular Weight | 446.80 g/mol |
| Exact Mass | 445.10 |
| IUPAC Name | (1R,4aS,9E,10aR)-5,6,8-trichloro-9-methoxyimino-1,4a-dimethyl-7-propan-2-yl-3,4,10,10a-tetrahydro-2H-phenanthrene-1-carboxylic acid |
| SMILES | CO/N=C1\C[C@H]2[C@](C)(C(=O)O)CCC[C@]2(C)c2c(Cl)c(Cl)c(C(C)C)c(Cl)c21 |
| InChI | InChI=1S/C21H26Cl3NO3/c1-10(2)13-16(22)14-11(25-28-5)9-12-20(3,15(14)18(24)17(13)23)7-6-8-21(12,4)19(26)27/h10,12H,6-9H2,1-5H3,(H,26,27)/b25-11+/t12-,20+,21-/m1/s1 |
| InChIKey | FNEPSXSQXYOYSO-ZYGCRCMOSA-N |
| XLogP | 6.67 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.80 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|