About benzotriazol-1-yl 3,4,5-trimethoxybenzoate
benzotriazol-1-yl 3,4,5-trimethoxybenzoate (PubChem CID 50898980) has the molecular formula C16H15N3O5
and a molecular weight of 329.31 g/mol. Its IUPAC name is benzotriazol-1-yl 3,4,5-trimethoxybenzoate.
Molecular Properties
| Compound Name | benzotriazol-1-yl 3,4,5-trimethoxybenzoate |
| PubChem CID | 50898980 |
| Molecular Formula | C16H15N3O5 |
| Molecular Weight | 329.31 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | benzotriazol-1-yl 3,4,5-trimethoxybenzoate |
| SMILES | COc1cc(C(=O)On2nnc3ccccc32)cc(OC)c1OC |
| InChI | InChI=1S/C16H15N3O5/c1-21-13-8-10(9-14(22-2)15(13)23-3)16(20)24-19-12-7-5-4-6-11(12)17-18-19/h4-9H,1-3H3 |
| InChIKey | PJIKVVCQXLHJHV-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 84.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.31 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ester_of_HOBT', 'substructure': 'N/A'} |
|---|
Analyze benzotriazol-1-yl 3,4,5-trimethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzotriazol-1-yl 3,4,5-trimethoxybenzoate?
The IUPAC name of benzotriazol-1-yl 3,4,5-trimethoxybenzoate (CID 50898980) is benzotriazol-1-yl 3,4,5-trimethoxybenzoate.
What is the SMILES notation for benzotriazol-1-yl 3,4,5-trimethoxybenzoate?
The canonical SMILES for benzotriazol-1-yl 3,4,5-trimethoxybenzoate is COc1cc(C(=O)On2nnc3ccccc32)cc(OC)c1OC.
What is the InChIKey of benzotriazol-1-yl 3,4,5-trimethoxybenzoate?
The InChIKey is PJIKVVCQXLHJHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N3O5/c1-21-13-8-10(9-14(22-2)15(13)23-3)16(20)24-19-12-7-5-4-6-11(12)17-18-19/h4-9H,1-3H3.
What are the key properties of benzotriazol-1-yl 3,4,5-trimethoxybenzoate?
benzotriazol-1-yl 3,4,5-trimethoxybenzoate has a molecular weight of 329.31 g/mol, XLogP of 1.73, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for benzotriazol-1-yl 3,4,5-trimethoxybenzoate is sourced from PubChem (CID 50898980), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).