About 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide
4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide (PubChem CID 50899050) has the molecular formula C26H25N3O2
and a molecular weight of 411.51 g/mol. Its IUPAC name is 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide.
Molecular Properties
| Compound Name | 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide |
| PubChem CID | 50899050 |
| Molecular Formula | C26H25N3O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.19 |
| IUPAC Name | 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide |
| SMILES | O=C(NO)c1ccc(Cn2c3c(c4ccccc42)CCN(Cc2ccccc2)C3)cc1 |
| InChI | InChI=1S/C26H25N3O2/c30-26(27-31)21-12-10-20(11-13-21)17-29-24-9-5-4-8-22(24)23-14-15-28(18-25(23)29)16-19-6-2-1-3-7-19/h1-13,31H,14-18H2,(H,27,30) |
| InChIKey | JRTPVXBTIBXZAF-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide?
The IUPAC name of 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide (CID 50899050) is 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide.
What is the SMILES notation for 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide?
The canonical SMILES for 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide is O=C(NO)c1ccc(Cn2c3c(c4ccccc42)CCN(Cc2ccccc2)C3)cc1.
What is the InChIKey of 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide?
The InChIKey is JRTPVXBTIBXZAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H25N3O2/c30-26(27-31)21-12-10-20(11-13-21)17-29-24-9-5-4-8-22(24)23-14-15-28(18-25(23)29)16-19-6-2-1-3-7-19/h1-13,31H,14-18H2,(H,27,30).
What are the key properties of 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide?
4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide has a molecular weight of 411.51 g/mol, XLogP of 4.37, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2-benzyl-3,4-dihydro-1H-pyrido[3,4-b]indol-9-yl)methyl]-N-hydroxybenzamide is sourced from PubChem (CID 50899050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).