C21H26ClN7O — CID 50899059
N-[3-[[6-chloro-4-(5H-pyrrolo[2,3-b]pyrazin-7-yl)-2-pyridinyl]amino]cyclohexyl]-2-(dimethylamino)acetamide (PubChem CID 50899059) has the molecular formula C21H26ClN7O and a molecular weight of 427.94 g/mol. Its IUPAC name is N-[3-[[6-chloro-4-(5H-pyrrolo[2,3-b]pyrazin-7-yl)-2-pyridinyl]amino]cyclohexyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[3-[[6-chloro-4-(5H-pyrrolo[2,3-b]pyrazin-7-yl)-2-pyridinyl]amino]cyclohexyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 50899059 |
| Molecular Formula | C21H26ClN7O |
| Molecular Weight | 427.94 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | N-[3-[[6-chloro-4-(5H-pyrrolo[2,3-b]pyrazin-7-yl)-2-pyridinyl]amino]cyclohexyl]-2-(dimethylamino)acetamide |
| SMILES | CN(C)CC(=O)NC1CCCC(Nc2cc(-c3c[nH]c4nccnc34)cc(Cl)n2)C1 |
| InChI | InChI=1S/C21H26ClN7O/c1-29(2)12-19(30)27-15-5-3-4-14(10-15)26-18-9-13(8-17(22)28-18)16-11-25-21-20(16)23-6-7-24-21/h6-9,11,14-15H,3-5,10,12H2,1-2H3,(H,24,25)(H,26,28)(H,27,30) |
| InChIKey | FKMRSCQNDPQRTP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 98.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.94 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|