C23H30ClN7O — CID 50899063
N-[3-[[6-chloro-4-(5H-pyrrolo[2,3-b]pyrazin-7-yl)-2-pyridinyl]-ethylamino]cyclohexyl]-2-(dimethylamino)acetamide (PubChem CID 50899063) has the molecular formula C23H30ClN7O and a molecular weight of 455.99 g/mol. Its IUPAC name is N-[3-[[6-chloro-4-(5H-pyrrolo[2,3-b]pyrazin-7-yl)-2-pyridinyl]-ethylamino]cyclohexyl]-2-(dimethylamino)acetamide.
| Compound Name | N-[3-[[6-chloro-4-(5H-pyrrolo[2,3-b]pyrazin-7-yl)-2-pyridinyl]-ethylamino]cyclohexyl]-2-(dimethylamino)acetamide |
|---|---|
| PubChem CID | 50899063 |
| Molecular Formula | C23H30ClN7O |
| Molecular Weight | 455.99 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | N-[3-[[6-chloro-4-(5H-pyrrolo[2,3-b]pyrazin-7-yl)-2-pyridinyl]-ethylamino]cyclohexyl]-2-(dimethylamino)acetamide |
| SMILES | CCN(c1cc(-c2c[nH]c3nccnc23)cc(Cl)n1)C1CCCC(NC(=O)CN(C)C)C1 |
| InChI | InChI=1S/C23H30ClN7O/c1-4-31(17-7-5-6-16(12-17)28-21(32)14-30(2)3)20-11-15(10-19(24)29-20)18-13-27-23-22(18)25-8-9-26-23/h8-11,13,16-17H,4-7,12,14H2,1-3H3,(H,26,27)(H,28,32) |
| InChIKey | ASBFNTULALGXQF-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.99 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|