C33H29ClINO4 — CID 50899213
21-[3-(4-chloronaphthalen-1-yl)propyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene iodide (PubChem CID 50899213) has the molecular formula C33H29ClINO4 and a molecular weight of 665.96 g/mol. Its IUPAC name is 21-[3-(4-chloronaphthalen-1-yl)propyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene iodide.
| Compound Name | 21-[3-(4-chloronaphthalen-1-yl)propyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene iodide |
|---|---|
| PubChem CID | 50899213 |
| Molecular Formula | C33H29ClINO4 |
| Molecular Weight | 665.96 g/mol |
| Exact Mass | 665.08 |
| IUPAC Name | 21-[3-(4-chloronaphthalen-1-yl)propyl]-16,17-dimethoxy-5,7-dioxa-13-azoniapentacyclo[11.8.0.02,10.04,8.015,20]henicosa-1(13),2,4(8),9,14,16,18,20-octaene iodide |
| SMILES | COc1ccc2c(CCCc3ccc(Cl)c4ccccc34)c3[n+](cc2c1OC)CCc1cc2c(cc1-3)OCO2.[I-] |
| InChI | InChI=1S/C33H29ClNO4.HI/c1-36-29-13-11-23-25(9-5-6-20-10-12-28(34)24-8-4-3-7-22(20)24)32-26-17-31-30(38-19-39-31)16-21(26)14-15-35(32)18-27(23)33(29)37-2;/h3-4,7-8,10-13,16-18H,5-6,9,14-15,19H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | ZLPRBKMWCLYUEO-UHFFFAOYSA-M |
| XLogP | 4.08 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 665.96 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|