About N'-benzhydrylethanimidamide;hydrobromide
N'-benzhydrylethanimidamide;hydrobromide (PubChem CID 50899558) has the molecular formula C15H17BrN2
and a molecular weight of 305.22 g/mol. Its IUPAC name is N'-benzhydrylethanimidamide;hydrobromide.
Molecular Properties
| Compound Name | N'-benzhydrylethanimidamide;hydrobromide |
| PubChem CID | 50899558 |
| Molecular Formula | C15H17BrN2 |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.06 |
| IUPAC Name | N'-benzhydrylethanimidamide;hydrobromide |
| SMILES | Br.C/C(N)=N\C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C15H16N2.BrH/c1-12(16)17-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-11,15H,1H3,(H2,16,17);1H |
| InChIKey | SCBRUNBFSUXITM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-benzhydrylethanimidamide;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzhydrylethanimidamide;hydrobromide?
The IUPAC name of N'-benzhydrylethanimidamide;hydrobromide (CID 50899558) is N'-benzhydrylethanimidamide;hydrobromide.
What is the SMILES notation for N'-benzhydrylethanimidamide;hydrobromide?
The canonical SMILES for N'-benzhydrylethanimidamide;hydrobromide is Br.C/C(N)=N\C(c1ccccc1)c1ccccc1.
What is the InChIKey of N'-benzhydrylethanimidamide;hydrobromide?
The InChIKey is SCBRUNBFSUXITM-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2.BrH/c1-12(16)17-15(13-8-4-2-5-9-13)14-10-6-3-7-11-14;/h2-11,15H,1H3,(H2,16,17);1H.
What are the key properties of N'-benzhydrylethanimidamide;hydrobromide?
N'-benzhydrylethanimidamide;hydrobromide has a molecular weight of 305.22 g/mol, XLogP of 3.73, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzhydrylethanimidamide;hydrobromide is sourced from PubChem (CID 50899558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).