C18H18Cl2N2O3S2 — CID 50899771
N-[3-[2-(2,3-dichlorobenzoyl)-5-methylthieno[2,3-b]pyrrol-6-yl]propyl]methanesulfonamide (PubChem CID 50899771) has the molecular formula C18H18Cl2N2O3S2 and a molecular weight of 445.39 g/mol. Its IUPAC name is N-[3-[2-(2,3-dichlorobenzoyl)-5-methylthieno[2,3-b]pyrrol-6-yl]propyl]methanesulfonamide.
| Compound Name | N-[3-[2-(2,3-dichlorobenzoyl)-5-methylthieno[2,3-b]pyrrol-6-yl]propyl]methanesulfonamide |
|---|---|
| PubChem CID | 50899771 |
| Molecular Formula | C18H18Cl2N2O3S2 |
| Molecular Weight | 445.39 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | N-[3-[2-(2,3-dichlorobenzoyl)-5-methylthieno[2,3-b]pyrrol-6-yl]propyl]methanesulfonamide |
| SMILES | Cc1cc2cc(C(=O)c3cccc(Cl)c3Cl)sc2n1CCCNS(C)(=O)=O |
| InChI | InChI=1S/C18H18Cl2N2O3S2/c1-11-9-12-10-15(17(23)13-5-3-6-14(19)16(13)20)26-18(12)22(11)8-4-7-21-27(2,24)25/h3,5-6,9-10,21H,4,7-8H2,1-2H3 |
| InChIKey | QOEHHQZAFFBACK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.39 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|