C29H24Br2O2 — CID 50900000
ethyl 3,4-bis(4-bromophenyl)-2,5-dimethyl-6-phenylbenzoate (PubChem CID 50900000) has the molecular formula C29H24Br2O2 and a molecular weight of 564.32 g/mol. Its IUPAC name is ethyl 3,4-bis(4-bromophenyl)-2,5-dimethyl-6-phenylbenzoate.
| Compound Name | ethyl 3,4-bis(4-bromophenyl)-2,5-dimethyl-6-phenylbenzoate |
|---|---|
| PubChem CID | 50900000 |
| Molecular Formula | C29H24Br2O2 |
| Molecular Weight | 564.32 g/mol |
| Exact Mass | 562.01 |
| IUPAC Name | ethyl 3,4-bis(4-bromophenyl)-2,5-dimethyl-6-phenylbenzoate |
| SMILES | CCOC(=O)c1c(C)c(-c2ccc(Br)cc2)c(-c2ccc(Br)cc2)c(C)c1-c1ccccc1 |
| InChI | InChI=1S/C29H24Br2O2/c1-4-33-29(32)28-19(3)26(22-12-16-24(31)17-13-22)25(21-10-14-23(30)15-11-21)18(2)27(28)20-8-6-5-7-9-20/h5-17H,4H2,1-3H3 |
| InChIKey | ORAYOGFORJIQPC-UHFFFAOYSA-N |
| XLogP | 9.01 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.32 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |