C26H40O7 — CID 50900137
[(1R,2R,6R,7R,8R,9R,12S)-12-hydroxy-6-[(2R)-1-hydroxypropan-2-yl]-9-methyl-3,13-dimethylidene-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] 2-acetyloxybutanoate (PubChem CID 50900137) has the molecular formula C26H40O7 and a molecular weight of 464.60 g/mol. Its IUPAC name is [(1R,2R,6R,7R,8R,9R,12S)-12-hydroxy-6-[(2R)-1-hydroxypropan-2-yl]-9-methyl-3,13-dimethylidene-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] 2-acetyloxybutanoate.
| Compound Name | [(1R,2R,6R,7R,8R,9R,12S)-12-hydroxy-6-[(2R)-1-hydroxypropan-2-yl]-9-methyl-3,13-dimethylidene-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] 2-acetyloxybutanoate |
|---|---|
| PubChem CID | 50900137 |
| Molecular Formula | C26H40O7 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | [(1R,2R,6R,7R,8R,9R,12S)-12-hydroxy-6-[(2R)-1-hydroxypropan-2-yl]-9-methyl-3,13-dimethylidene-15-oxatricyclo[6.6.1.02,7]pentadecan-9-yl] 2-acetyloxybutanoate |
| SMILES | C=C1CC[C@H]([C@@H](C)CO)[C@@H]2[C@H]1[C@H]1CC(=C)[C@@H](O)CC[C@@](C)(OC(=O)C(CC)OC(C)=O)[C@@H]2O1 |
| InChI | InChI=1S/C26H40O7/c1-7-20(31-17(5)28)25(30)33-26(6)11-10-19(29)15(3)12-21-22-14(2)8-9-18(16(4)13-27)23(22)24(26)32-21/h16,18-24,27,29H,2-3,7-13H2,1,4-6H3/t16-,18+,19-,20?,21+,22+,23+,24+,26+/m0/s1 |
| InChIKey | QEAWUOKMRPXMSH-HMHWPQCPSA-N |
| XLogP | 3.33 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|