C24H40O5 — CID 50900138
[(1R,2R,6R,7R,8R,9R,12S,13S)-12,13-dihydroxy-3,9,13-trimethyl-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-3-en-9-yl] butanoate (PubChem CID 50900138) has the molecular formula C24H40O5 and a molecular weight of 408.58 g/mol. Its IUPAC name is [(1R,2R,6R,7R,8R,9R,12S,13S)-12,13-dihydroxy-3,9,13-trimethyl-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-3-en-9-yl] butanoate.
| Compound Name | [(1R,2R,6R,7R,8R,9R,12S,13S)-12,13-dihydroxy-3,9,13-trimethyl-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-3-en-9-yl] butanoate |
|---|---|
| PubChem CID | 50900138 |
| Molecular Formula | C24H40O5 |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.29 |
| IUPAC Name | [(1R,2R,6R,7R,8R,9R,12S,13S)-12,13-dihydroxy-3,9,13-trimethyl-6-propan-2-yl-15-oxatricyclo[6.6.1.02,7]pentadec-3-en-9-yl] butanoate |
| SMILES | CCCC(=O)O[C@]1(C)CC[C@H](O)[C@@](C)(O)C[C@H]2O[C@@H]1[C@H]1[C@@H]2C(C)=CC[C@@H]1C(C)C |
| InChI | InChI=1S/C24H40O5/c1-7-8-19(26)29-24(6)12-11-18(25)23(5,27)13-17-20-15(4)9-10-16(14(2)3)21(20)22(24)28-17/h9,14,16-18,20-22,25,27H,7-8,10-13H2,1-6H3/t16-,17-,18+,20-,21-,22-,23+,24-/m1/s1 |
| InChIKey | AOODOWQDWVZWQC-QGLKYHSXSA-N |
| XLogP | 4.01 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|