C30H44O5 — CID 50900151
(2S,4S,7R,8S,9S,12R,13R,18R)-7-[(E)-4-hydroperoxy-4-methylpent-2-enyl]-2,9,13,17,17-pentamethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-1(20)-ene-6,16-dione (PubChem CID 50900151) has the molecular formula C30H44O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is (2S,4S,7R,8S,9S,12R,13R,18R)-7-[(E)-4-hydroperoxy-4-methylpent-2-enyl]-2,9,13,17,17-pentamethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-1(20)-ene-6,16-dione.
| Compound Name | (2S,4S,7R,8S,9S,12R,13R,18R)-7-[(E)-4-hydroperoxy-4-methylpent-2-enyl]-2,9,13,17,17-pentamethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-1(20)-ene-6,16-dione |
|---|---|
| PubChem CID | 50900151 |
| Molecular Formula | C30H44O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.32 |
| IUPAC Name | (2S,4S,7R,8S,9S,12R,13R,18R)-7-[(E)-4-hydroperoxy-4-methylpent-2-enyl]-2,9,13,17,17-pentamethyl-5-oxapentacyclo[10.8.0.02,9.04,8.013,18]icos-1(20)-ene-6,16-dione |
| SMILES | CC(C)(/C=C/C[C@H]1C(=O)O[C@H]2C[C@]3(C)C4=CC[C@H]5C(C)(C)C(=O)CC[C@]5(C)[C@H]4CC[C@@]3(C)[C@@H]21)OO |
| InChI | InChI=1S/C30H44O5/c1-26(2,35-33)14-8-9-18-24-21(34-25(18)32)17-30(7)20-10-11-22-27(3,4)23(31)13-15-28(22,5)19(20)12-16-29(24,30)6/h8,10,14,18-19,21-22,24,33H,9,11-13,15-17H2,1-7H3/b14-8+/t18-,19+,21+,22+,24-,28-,29+,30-/m1/s1 |
| InChIKey | LQPSEQWINGOYLK-UHVZVPEASA-N |
| XLogP | 6.53 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|