C35H54O5 — CID 50900497
5-[[(4aS,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picen-4a-yl]methoxy]-5-oxopentanoic acid (PubChem CID 50900497) has the molecular formula C35H54O5 and a molecular weight of 554.81 g/mol. Its IUPAC name is 5-[[(4aS,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picen-4a-yl]methoxy]-5-oxopentanoic acid.
| Compound Name | 5-[[(4aS,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picen-4a-yl]methoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 50900497 |
| Molecular Formula | C35H54O5 |
| Molecular Weight | 554.81 g/mol |
| Exact Mass | 554.40 |
| IUPAC Name | 5-[[(4aS,6aS,6bR,8aR,12aR,14bS)-2,2,6a,6b,9,9,12a-heptamethyl-10-oxo-3,4,5,6,6a,7,8,8a,11,12,13,14b-dodecahydro-1H-picen-4a-yl]methoxy]-5-oxopentanoic acid |
| SMILES | CC1(C)CC[C@]2(COC(=O)CCCC(=O)O)CC[C@]3(C)C(=CCC4[C@@]5(C)CCC(=O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]2C1 |
| InChI | InChI=1S/C35H54O5/c1-30(2)17-19-35(22-40-29(39)10-8-9-28(37)38)20-18-33(6)23(24(35)21-30)11-12-26-32(5)15-14-27(36)31(3,4)25(32)13-16-34(26,33)7/h11,24-26H,8-10,12-22H2,1-7H3,(H,37,38)/t24-,25-,26?,32-,33+,34+,35+/m0/s1 |
| InChIKey | WGMAUSSPMJLUMF-WUWUUHJQSA-N |
| XLogP | 8.16 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.81 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|