C17H12Cl2N2O4 — CID 50901568
ethyl 2-(2,4-dichlorophenyl)-1-nitroindolizine-3-carboxylate (PubChem CID 50901568) has the molecular formula C17H12Cl2N2O4 and a molecular weight of 379.20 g/mol. Its IUPAC name is ethyl 2-(2,4-dichlorophenyl)-1-nitroindolizine-3-carboxylate.
| Compound Name | ethyl 2-(2,4-dichlorophenyl)-1-nitroindolizine-3-carboxylate |
|---|---|
| PubChem CID | 50901568 |
| Molecular Formula | C17H12Cl2N2O4 |
| Molecular Weight | 379.20 g/mol |
| Exact Mass | 378.02 |
| IUPAC Name | ethyl 2-(2,4-dichlorophenyl)-1-nitroindolizine-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(Cl)cc2Cl)c([N+](=O)[O-])c2ccccn12 |
| InChI | InChI=1S/C17H12Cl2N2O4/c1-2-25-17(22)16-14(11-7-6-10(18)9-12(11)19)15(21(23)24)13-5-3-4-8-20(13)16/h3-9H,2H2,1H3 |
| InChIKey | OPVPXUDBQJQENZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 73.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.20 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|