About 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde
5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde (PubChem CID 50901715) has the molecular formula C14H12O3S2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde.
Molecular Properties
| Compound Name | 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde |
| PubChem CID | 50901715 |
| Molecular Formula | C14H12O3S2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde |
| SMILES | O=Cc1ccc(/C=C/c2ccc(C3OCCO3)s2)s1 |
| InChI | InChI=1S/C14H12O3S2/c15-9-12-4-3-10(18-12)1-2-11-5-6-13(19-11)14-16-7-8-17-14/h1-6,9,14H,7-8H2/b2-1+ |
| InChIKey | SVWOFXFSHPUVAF-OWOJBTEDSA-N |
| XLogP | 3.84 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde?
The IUPAC name of 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde (CID 50901715) is 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde.
What is the SMILES notation for 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde?
The canonical SMILES for 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde is O=Cc1ccc(/C=C/c2ccc(C3OCCO3)s2)s1.
What is the InChIKey of 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde?
The InChIKey is SVWOFXFSHPUVAF-OWOJBTEDSA-N. The full InChI is InChI=1S/C14H12O3S2/c15-9-12-4-3-10(18-12)1-2-11-5-6-13(19-11)14-16-7-8-17-14/h1-6,9,14H,7-8H2/b2-1+.
What are the key properties of 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde?
5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde has a molecular weight of 292.38 g/mol, XLogP of 3.84, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(E)-2-[5-(1,3-dioxolan-2-yl)thiophen-2-yl]ethenyl]thiophene-2-carbaldehyde is sourced from PubChem (CID 50901715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).