C25H32O7 — CID 50901726
(2R)-2-[(E)-3-[(2S,4R,5S,6R)-4,5-bis(methoxymethoxy)-6-[(E)-2-phenylethenyl]oxan-2-yl]prop-1-enyl]-2,3-dihydropyran-6-one (PubChem CID 50901726) has the molecular formula C25H32O7 and a molecular weight of 444.52 g/mol. Its IUPAC name is (2R)-2-[(E)-3-[(2S,4R,5S,6R)-4,5-bis(methoxymethoxy)-6-[(E)-2-phenylethenyl]oxan-2-yl]prop-1-enyl]-2,3-dihydropyran-6-one.
| Compound Name | (2R)-2-[(E)-3-[(2S,4R,5S,6R)-4,5-bis(methoxymethoxy)-6-[(E)-2-phenylethenyl]oxan-2-yl]prop-1-enyl]-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 50901726 |
| Molecular Formula | C25H32O7 |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.21 |
| IUPAC Name | (2R)-2-[(E)-3-[(2S,4R,5S,6R)-4,5-bis(methoxymethoxy)-6-[(E)-2-phenylethenyl]oxan-2-yl]prop-1-enyl]-2,3-dihydropyran-6-one |
| SMILES | COCO[C@@H]1[C@@H](/C=C/c2ccccc2)O[C@@H](C/C=C/[C@H]2CC=CC(=O)O2)C[C@H]1OCOC |
| InChI | InChI=1S/C25H32O7/c1-27-17-29-23-16-21(12-6-10-20-11-7-13-24(26)32-20)31-22(25(23)30-18-28-2)15-14-19-8-4-3-5-9-19/h3-10,13-15,20-23,25H,11-12,16-18H2,1-2H3/b10-6+,15-14+/t20-,21-,22+,23+,25+/m0/s1 |
| InChIKey | KWZGFUMGYNKHDV-AIZKODKSSA-N |
| XLogP | 3.65 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|