C15H29NO7 — CID 50901756
tert-butyl N-[(2S,3S,4S)-1-hydroxy-3,4-bis(methoxymethoxy)hex-5-en-2-yl]carbamate (PubChem CID 50901756) has the molecular formula C15H29NO7 and a molecular weight of 335.40 g/mol. Its IUPAC name is tert-butyl N-[(2S,3S,4S)-1-hydroxy-3,4-bis(methoxymethoxy)hex-5-en-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S,3S,4S)-1-hydroxy-3,4-bis(methoxymethoxy)hex-5-en-2-yl]carbamate |
|---|---|
| PubChem CID | 50901756 |
| Molecular Formula | C15H29NO7 |
| Molecular Weight | 335.40 g/mol |
| Exact Mass | 335.19 |
| IUPAC Name | tert-butyl N-[(2S,3S,4S)-1-hydroxy-3,4-bis(methoxymethoxy)hex-5-en-2-yl]carbamate |
| SMILES | C=C[C@H](OCOC)[C@@H](OCOC)[C@H](CO)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H29NO7/c1-7-12(21-9-19-5)13(22-10-20-6)11(8-17)16-14(18)23-15(2,3)4/h7,11-13,17H,1,8-10H2,2-6H3,(H,16,18)/t11-,12-,13-/m0/s1 |
| InChIKey | WRVINRHTELGQCK-AVGNSLFASA-N |
| XLogP | 1.04 |
| TPSA | 95.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|