C15H24O5 — CID 50901889
tert-butyl (2S,4aR,5R,7aS)-2-methoxy-7a-methyl-6-oxo-2,3,4,4a,5,7-hexahydrocyclopenta[b]pyran-5-carboxylate (PubChem CID 50901889) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is tert-butyl (2S,4aR,5R,7aS)-2-methoxy-7a-methyl-6-oxo-2,3,4,4a,5,7-hexahydrocyclopenta[b]pyran-5-carboxylate.
| Compound Name | tert-butyl (2S,4aR,5R,7aS)-2-methoxy-7a-methyl-6-oxo-2,3,4,4a,5,7-hexahydrocyclopenta[b]pyran-5-carboxylate |
|---|---|
| PubChem CID | 50901889 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | tert-butyl (2S,4aR,5R,7aS)-2-methoxy-7a-methyl-6-oxo-2,3,4,4a,5,7-hexahydrocyclopenta[b]pyran-5-carboxylate |
| SMILES | CO[C@@H]1CC[C@@H]2[C@@H](C(=O)OC(C)(C)C)C(=O)C[C@]2(C)O1 |
| InChI | InChI=1S/C15H24O5/c1-14(2,3)20-13(17)12-9-6-7-11(18-5)19-15(9,4)8-10(12)16/h9,11-12H,6-8H2,1-5H3/t9-,11+,12-,15+/m1/s1 |
| InChIKey | ZDAVAQVFBLHTQR-FQMFCJFBSA-N |
| XLogP | 2.07 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|