C27H33NO6 — CID 50901961
[(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] N-phenylcarbamate (PubChem CID 50901961) has the molecular formula C27H33NO6 and a molecular weight of 467.56 g/mol. Its IUPAC name is [(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] N-phenylcarbamate.
| Compound Name | [(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 50901961 |
| Molecular Formula | C27H33NO6 |
| Molecular Weight | 467.56 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | [(1R,2S,6R,10S,11R,13S,15R)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5-oxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] N-phenylcarbamate |
| SMILES | CC1=C[C@H]2[C@@]3(O)[C@H](C)C[C@]4(OC(=O)Nc5ccccc5)[C@H]([C@@H]3C=C(CO)C[C@]2(O)C1=O)C4(C)C |
| InChI | InChI=1S/C27H33NO6/c1-15-10-20-25(32,22(15)30)13-17(14-29)11-19-21-24(3,4)26(21,12-16(2)27(19,20)33)34-23(31)28-18-8-6-5-7-9-18/h5-11,16,19-21,29,32-33H,12-14H2,1-4H3,(H,28,31)/t16-,19+,20-,21-,25-,26+,27-/m1/s1 |
| InChIKey | GAJTUKGYHZYSEX-IPXOMDPPSA-N |
| XLogP | 3.22 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|